Skip to content

STEP2 2009 -- Pure Mathematics

Exam: STEP2  |  Year: 2009  |  Questions: Q1—Q8  |  Total marks per question: 20

All questions are pure mathematics. Solutions and examiner commentary are included below.

QTopicDifficultyKey Techniques
1解析几何 (Coordinate Geometry)Standard坐标对称性,斜率判定矩形,代数化简,利用曲线方程消元
2函数与微积分 (Functions and Calculus)Challenging隐函数求导,三角函数性质,小量近似,对数化简,分段积分
3三角函数 (Trigonometry)Standard三角恒等变换,正切加法公式,分母有理化,迭代应用恒等式
4多项式 (Polynomials)Challenging多项式因式分解,求导与整除性,利用导数阶数确定因式,积分确定系数
5积分 (Integration)Standard根式化简,分段积分,面积与积分的区别,绝对值处理
6数列与级数 (Sequences and Series)Challenging递推关系放缩, 几何级数求和, 分奇偶项估计
7微积分 (Calculus)Challenging乘积法则, 因式分解, 线性组合凑微分
8向量 (Vectors)Standard位置向量运算, 参数消元, 向量共线条件

Topic: 解析几何 (Coordinate Geometry)  |  Difficulty: Standard  |  Marks: 20

1 Two curves have equations x4+y4=ux^4 + y^4 = u and xy=vxy = v, where uu and vv are positive constants. State the equations of the lines of symmetry of each curve.

The curves intersect at the distinct points A,B,CA, B, C and DD (taken anticlockwise from AA). The coordinates of AA are (α,β)(\alpha, \beta), where α>β>0\alpha > \beta > 0. Write down, in terms of α\alpha and β\beta, the coordinates of B,CB, C and DD.

Show that the quadrilateral ABCDABCD is a rectangle and find its area in terms of uu and vv only. Verify that, for the case u=81u = 81 and v=4v = 4, the area is 14.

Hint

Both graphs are symmetric in the lines y=±xy = \pm x, and x4+y4=ux^4 + y^4 = u is also symmetric in the xx- and yy-axes. These facts immediately enable us to write down the coordinates of B(β,α)B(\beta, \alpha), C(α,β)C(-\alpha, -\beta) and D(β,α)D(-\beta, -\alpha). Remember to keep the cyclic order A,B,C,DA, B, C, D correct, else this could lead to silly calculational errors later on. The easiest way to show that ABCDABCD is a rectangle is to work out the gradients of the four sides (which turn out to be either 11 or 1-1) and then note that each pair of adjacent sides is perpendicular using the “product of gradients =1= -1” result. Working with distances is also a possible solution-approach but, on its own, only establishes that the quadrilateral is a parallelogram. However, the next part requires you to calculate distances anyhow, and we find that CB,DACB, DA have length (α+β)2(\alpha + \beta)\sqrt{2} while BA,DCBA, DC are of length (αβ)2(\alpha - \beta)\sqrt{2}. Multiplying these then give the area of ABCDABCD as 2(α2β2)2(\alpha^2 - \beta^2).

All of this is very straightforward, and the only tricky bit of work comes next. It is important to think of α\alpha and β\beta as particular values of xx and yy satisfying each of the two original equations. It is then clear that (α2β2)2=α4+β42(α2β2)=u2v2(\alpha^2 - \beta^2)^2 = \alpha^4 + \beta^4 - 2(\alpha^2 \beta^2) = u - 2v^2, so that Area ABCD=2u2v2\text{Area } ABCD = 2\sqrt{u - 2v^2}. Substituting u=81,v=4u = 81, v = 4 into this formula then gives Area=2812×16=14\text{Area} = 2\sqrt{81 - 2 \times 16} = 14, which is intended principally as a means of checking that your answer is correct.

Model Solution

Lines of symmetry.

For x4+y4=ux^4 + y^4 = u: replacing xx with x-x, or yy with y-y, or swapping xx and yy, or replacing (x,y)(x, y) with (x,y)(-x, -y) all leave the equation unchanged. So the lines of symmetry are x=0x = 0, y=0y = 0, y=xy = x and y=xy = -x.

For xy=vxy = v: swapping xx and yy leaves the equation unchanged, and replacing (x,y)(x, y) with (x,y)(-x, -y) also leaves it unchanged. So the lines of symmetry are y=xy = x and y=xy = -x.

Coordinates of BB, CC, DD.

Since A=(α,β)A = (\alpha, \beta) lies on both curves, we have α4+β4=u\alpha^4 + \beta^4 = u and αβ=v\alpha\beta = v. Both curves are symmetric in y=xy = x, so (β,α)(\beta, \alpha) also lies on both curves. Both curves are symmetric in the origin (replacing (x,y)(x,y) with (x,y)(-x,-y)), so (α,β)(-\alpha, -\beta) and (β,α)(-\beta, -\alpha) also lie on both curves.

The four intersection points, taken anticlockwise from AA in the first quadrant, are:

A=(α,β),B=(β,α),C=(α,β),D=(β,α).A = (\alpha, \beta), \quad B = (\beta, \alpha), \quad C = (-\alpha, -\beta), \quad D = (-\beta, -\alpha).

Showing ABCDABCD is a rectangle.

We compute the gradients of the four sides:

mAB=αββα=1,mBC=βααβ=1,m_{AB} = \frac{\alpha - \beta}{\beta - \alpha} = -1, \qquad m_{BC} = \frac{-\beta - \alpha}{-\alpha - \beta} = 1,

mCD=α+ββ+α=1,mDA=α+ββ+α=1.m_{CD} = \frac{-\alpha + \beta}{-\beta + \alpha} = -1, \qquad m_{DA} = \frac{\alpha + \beta}{\beta + \alpha} = 1.

Since mABmBC=(1)(1)=1m_{AB} \cdot m_{BC} = (-1)(1) = -1, adjacent sides ABAB and BCBC are perpendicular. By the same calculation, every pair of adjacent sides is perpendicular. Since opposite sides have equal gradients (mAB=mCDm_{AB} = m_{CD} and mBC=mDAm_{BC} = m_{DA}), opposite sides are parallel. Therefore ABCDABCD is a rectangle. \quad \blacksquare

Area of ABCDABCD.

The side lengths are:

AB=(βα)2+(αβ)2=(αβ)2,AB = \sqrt{(\beta - \alpha)^2 + (\alpha - \beta)^2} = (\alpha - \beta)\sqrt{2},

BC=(αβ)2+(βα)2=(α+β)2.BC = \sqrt{(-\alpha - \beta)^2 + (-\beta - \alpha)^2} = (\alpha + \beta)\sqrt{2}.

Area=AB×BC=(αβ)2(α+β)2=2(α2β2).\text{Area} = AB \times BC = (\alpha - \beta)\sqrt{2} \cdot (\alpha + \beta)\sqrt{2} = 2(\alpha^2 - \beta^2).

Since α>β>0\alpha > \beta > 0, we have α2β2>0\alpha^2 - \beta^2 > 0, so the area is 2(α2β2)2(\alpha^2 - \beta^2).

To express this in terms of uu and vv, we use the fact that α\alpha and β\beta satisfy both curve equations: α4+β4=u\alpha^4 + \beta^4 = u and αβ=v\alpha\beta = v. Then:

(α2β2)2=α42α2β2+β4=(α4+β4)2(αβ)2=u2v2.(\alpha^2 - \beta^2)^2 = \alpha^4 - 2\alpha^2\beta^2 + \beta^4 = (\alpha^4 + \beta^4) - 2(\alpha\beta)^2 = u - 2v^2.

Since α2β2>0\alpha^2 - \beta^2 > 0:

Area=2(α2β2)=2u2v2.\text{Area} = 2(\alpha^2 - \beta^2) = 2\sqrt{u - 2v^2}.

Verification. Substituting u=81u = 81 and v=4v = 4:

Area=2812(16)=28132=249=14.\text{Area} = 2\sqrt{81 - 2(16)} = 2\sqrt{81 - 32} = 2\sqrt{49} = 14. \quad \checkmark

Examiner Notes

The first question is usually intended to be a gentle introduction to the paper, and to allow all candidates to gain some marks without making great demands on either memory or technical skills. This year, however, and for the first time that I can recall in recent years, the obviously algebraic nature of the question was enough to deter half the candidates from attempting it. Indeed, apart from Q8, it was the least popular pure maths question. This was a great pity: the helpful structure really did guide folks in the right direction, and any half-decent candidates who did try it usually scored very highly on it. There were, nonetheless, a couple of stumbling-blocks along the way for the less wary, and many candidates tripped over them. The point at which most of the less successful students started to go astray was when asked to show that ABCDABCD is a rectangle. Lots of these folk elected to do so by working out distances … when the use of gradients would have been much simpler. The really disappointing thing was that many simply showed both pairs of opposite sides to be equal in length without realising that this only proved the quadrilateral a parallelogram. The next major difficulty was to be found in the algebra, in turning the area, 2(α2β2)2(\alpha^2 - \beta^2), into something to do with uu and vv. It was quite apparent that many were unable to do so because they failed to appreciate that α\alpha and β\beta were particular values of xx and yy that satisfy the two original curve equations, so that α4+β4=u\alpha^4 + \beta^4 = u and αβ=v\alpha\beta = v. Then, squaring the area expression does the trick. Some got part of the way to grasping this idea, but approached from the direction of solving x4+y4=ux^4 + y^4 = u and xy=vxy = v as simultaneous equations; the resulting surds-within-surds expressions for α\alpha and β\beta were too indigestible for almost anyone to cope with.


Topic: 函数与微积分 (Functions and Calculus)  |  Difficulty: Challenging  |  Marks: 20

2 The curve CC has equation

y=asin(πex),y = a^{\sin(\pi e^x)},

where a>1a > 1.

(i) Find the coordinates of the stationary points on CC.

(ii) Use the approximations et1+te^t \approx 1 + t and sintt\sin t \approx t (both valid for small values of tt) to show that

y1πxlnay \approx 1 - \pi x \ln a

for small values of xx.

(iii) Sketch CC.

(iv) By approximating CC by means of straight lines joining consecutive stationary points, show that the area between CC and the xx-axis between the kkth and (k+1)(k + 1)th maxima is approximately

(a2+12a)ln(1+(k34)1).\left( \frac{a^2 + 1}{2a} \right) \ln \left( 1 + \left( k - \frac{3}{4} \right)^{-1} \right).

Hint

It is perfectly possible to differentiate a(sin[πex])a^{(\sin[\pi e^x])} by using the Chain Rule (on a function of a function of a function) but simplest to take logs and use implicit differentiation. Then, setting dydx=0\frac{dy}{dx} = 0 and noting that πex\pi e^x and lna\ln a are non-zero, we are left solving the eqn. cos(πex)=0\cos(\pi e^x) = 0 for the turning points.

This gives ex=(2n+1)12π    x=ln(n+12)e^x = (2n + 1)\frac{1}{2}\pi \implies x = \ln(n + \frac{1}{2}), y=ay = a or 1a\frac{1}{a}, depending upon whether nn is even or odd. Although not actually required at this point, it may be helpful to note at this stage that the evens give maxima while the odds give minima. There is, however, a much more obvious approach to finding the TPs that doesn’t require differentiation at all, and that is to use what should be well-known properties of the sine function: namely, that y=asin(πexpx)y = a^{\sin(\pi \exp x)} has maxima when sin(πex)=1\sin(\pi e^x) = 1, i.e. πex=(2n+12)π\pi e^x = (2n + \frac{1}{2})\pi, and x=ln(2n+12)x = \ln(2n + \frac{1}{2}) for n=0,1,n = 0, 1, \dots, with ymax=ay_{\max} = a. Similarly, minima occur when sin(πex)=1\sin(\pi e^x) = -1, i.e. πex=(2n12)π\pi e^x = (2n - \frac{1}{2})\pi, and x=ln(2n12)x = \ln(2n - \frac{1}{2}) for n=1,2,n = 1, 2, \dots, with ymin=1ay_{\min} = \frac{1}{a}.

(ii) Using the addition formula for sin(A+B)\sin(A + B), and the approximations given, we have sin(πex)sin(π+πx)=sin(πx)πx for small x,\sin(\pi e^x) \approx \sin(\pi + \pi x) = -\sin(\pi x) \approx -\pi x \text{ for small } x, leading to yaπx=eπxlna1πxlnay \approx a^{-\pi x} = e^{-\pi x \ln a} \approx 1 - \pi x \ln a.

(iii) Firstly, we can note that, for x<0x < 0, the curve has an asymptote y=1y = 1 (as x,y1+x \to -\infty, y \to 1^+). Next, for x>0x > 0, the curve oscillates between aa and 1a\frac{1}{a}, with the peaks and troughs getting ever closer together. The work in (i) helps us identify the TPs: the first max. occurs when n=0n = 0 at a negative value of xx [N.B. ln(12)<0\ln(\frac{1}{2}) < 0] at y=ay = a; while the result in (ii) tells us that the curve is approximately negative linear as it crosses the yy-axis.

(iv) The final part provides the only really tricky part to the question, and a quick diagram might be immensely useful here. Noting the relevant xx-coordinates x1=ln(2k32),x2=ln(2k12), and x3=ln(2k+12),x_1 = \ln(2k - \frac{3}{2}), x_2 = \ln(2k - \frac{1}{2}), \text{ and } x_3 = \ln(2k + \frac{1}{2}), the area is the sum of two trapezia (or rectangle - triangle), and manipulating ln(4k+14k3)=ln(4k3+44k3)=ln(1+1k34)\ln\left(\frac{4k + 1}{4k - 3}\right) = \ln\left(\frac{4k - 3 + 4}{4k - 3}\right) = \ln\left(1 + \frac{1}{k - \frac{3}{4}}\right) leads to the final, given answer.

Model Solution

Part (i)

Since y=asin(πex)y = a^{\sin(\pi e^x)} and a>1a > 1, the function ata^t is strictly increasing in tt. Therefore yy achieves its maxima when sin(πex)=1\sin(\pi e^x) = 1 and its minima when sin(πex)=1\sin(\pi e^x) = -1.

Maxima occur when sin(πex)=1\sin(\pi e^x) = 1, i.e. πex=2nπ+π2\pi e^x = 2n\pi + \frac{\pi}{2} for n=0,1,2,n = 0, 1, 2, \ldots, giving ex=2n+12e^x = 2n + \frac{1}{2}, so x=ln ⁣(2n+12)x = \ln\!\left(2n + \frac{1}{2}\right) and y=ay = a.

Minima occur when sin(πex)=1\sin(\pi e^x) = -1, i.e. πex=2nπ+3π2\pi e^x = 2n\pi + \frac{3\pi}{2} for n=0,1,2,n = 0, 1, 2, \ldots, giving ex=2n+32e^x = 2n + \frac{3}{2}, so x=ln ⁣(2n+32)x = \ln\!\left(2n + \frac{3}{2}\right) and y=1ay = \dfrac{1}{a}.

Equivalently, we can write the stationary points as:

x=ln ⁣(n+12),n=0,1,2,x = \ln\!\left(n + \tfrac{1}{2}\right), \quad n = 0, 1, 2, \ldots

with y=ay = a when nn is even (maxima) and y=1ay = \dfrac{1}{a} when nn is odd (minima).

Part (ii)

For small xx, we use the given approximations. First:

ex1+xe^x \approx 1 + x

so πexπ(1+x)=π+πx\pi e^x \approx \pi(1 + x) = \pi + \pi x. Then:

sin(πex)sin(π+πx).\sin(\pi e^x) \approx \sin(\pi + \pi x).

Using the identity sin(π+θ)=sinθ\sin(\pi + \theta) = -\sin\theta:

sin(π+πx)=sin(πx)πx\sin(\pi + \pi x) = -\sin(\pi x) \approx -\pi x

using sintt\sin t \approx t for small tt. Therefore:

y=asin(πex)aπx=eπxlna.y = a^{\sin(\pi e^x)} \approx a^{-\pi x} = e^{-\pi x \ln a}.

For small xx, eπxlna1πxlnae^{-\pi x \ln a} \approx 1 - \pi x \ln a. So:

y1πxlna.y \approx 1 - \pi x \ln a. \qquad \blacksquare

Part (iii)

The curve has the following features:

  • As xx \to -\infty, ex0e^x \to 0, so sin(πex)0\sin(\pi e^x) \to 0 and ya0=1y \to a^0 = 1 from above. So y=1y = 1 is a horizontal asymptote.
  • The curve crosses the xx-axis? No: y>0y > 0 always. At x=0x = 0: y=asin(π)=a0=1y = a^{\sin(\pi)} = a^0 = 1.
  • From part (ii), the curve is approximately y1πxlnay \approx 1 - \pi x \ln a near x=0x = 0, so it has negative slope there and dips below y=1y = 1.
  • For x>0x > 0, the curve oscillates between y=ay = a and y=1/ay = 1/a, with the oscillations getting increasingly rapid (the peaks and troughs get closer together) as exe^x grows.
  • The first maximum (n=0n = 0) occurs at x=ln12<0x = \ln\frac{1}{2} < 0 in the second quadrant region.

Part (iv)

We approximate the curve by straight lines between consecutive stationary points. The kkth maximum (where k=1,2,3,k = 1, 2, 3, \ldots, counting from the first maximum for x>0x > 0) occurs at

x=ln ⁣(2k32),y=a.x = \ln\!\left(2k - \tfrac{3}{2}\right), \quad y = a.

Wait — let me re-index. The maxima for x>0x > 0 correspond to n=0,1,2,n = 0, 1, 2, \ldots with x=ln(n+12)x = \ln(n + \frac{1}{2}). The first maximum with x>0x > 0 has n=0n = 0: x=ln12<0x = \ln\frac{1}{2} < 0. The second has n=1n = 1: x=ln52x = \ln\frac{5}{2}… Let me reconsider the indexing.

Actually, looking at the hint, the kkth maximum has xx-coordinate ln(2k32)\ln(2k - \frac{3}{2}). With k=1k = 1: x1=ln12<0x_1 = \ln\frac{1}{2} < 0. With k=2k = 2: x2=ln52>0x_2 = \ln\frac{5}{2} > 0.

The kkth minimum has xx-coordinate x2=ln(2k12)x_2 = \ln(2k - \frac{1}{2}) and the (k+1)(k+1)th maximum has x3=ln(2k+12)x_3 = \ln(2k + \frac{1}{2}).

The area between the kkth and (k+1)(k+1)th maxima is the area of the region enclosed by the curve and the xx-axis, approximated by two trapezia:

  • Trapezium 1: between x1=ln(2k32)x_1 = \ln(2k - \frac{3}{2}) and x2=ln(2k12)x_2 = \ln(2k - \frac{1}{2}), where yy goes from aa down to 1a\frac{1}{a}.
  • Trapezium 2: between x2=ln(2k12)x_2 = \ln(2k - \frac{1}{2}) and x3=ln(2k+12)x_3 = \ln(2k + \frac{1}{2}), where yy goes from 1a\frac{1}{a} back up to aa.

Trapezium 1:

A1=12(a+1a)(x2x1)=12a2+1aln ⁣(2k122k32).A_1 = \frac{1}{2}\left(a + \frac{1}{a}\right)(x_2 - x_1) = \frac{1}{2} \cdot \frac{a^2 + 1}{a} \cdot \ln\!\left(\frac{2k - \frac{1}{2}}{2k - \frac{3}{2}}\right).

Trapezium 2:

A2=12(1a+a)(x3x2)=12a2+1aln ⁣(2k+122k12).A_2 = \frac{1}{2}\left(\frac{1}{a} + a\right)(x_3 - x_2) = \frac{1}{2} \cdot \frac{a^2 + 1}{a} \cdot \ln\!\left(\frac{2k + \frac{1}{2}}{2k - \frac{1}{2}}\right).

Total area:

A=A1+A2=a2+12a[ln ⁣(4k14k3)+ln ⁣(4k+14k1)]=a2+12aln ⁣(4k+14k3).A = A_1 + A_2 = \frac{a^2 + 1}{2a} \left[\ln\!\left(\frac{4k - 1}{4k - 3}\right) + \ln\!\left(\frac{4k + 1}{4k - 1}\right)\right] = \frac{a^2 + 1}{2a} \ln\!\left(\frac{4k + 1}{4k - 3}\right).

Now we simplify the argument of the logarithm:

4k+14k3=4k3+44k3=1+44k3=1+1k34.\frac{4k + 1}{4k - 3} = \frac{4k - 3 + 4}{4k - 3} = 1 + \frac{4}{4k - 3} = 1 + \frac{1}{k - \frac{3}{4}}.

Therefore the area between the kkth and (k+1)(k+1)th maxima is approximately

a2+12aln ⁣(1+(k34)1).\frac{a^2 + 1}{2a} \ln\!\left(1 + \left(k - \frac{3}{4}\right)^{-1}\right). \qquad \blacksquare

Examiner Notes

Another of the less popular pure maths questions. It is clear that many A-level students are deeply suspicious of approximations and logarithms, and these plus the fact that yy is a “function of a function of a function” clearly signalled to many to pass by on the other side. Of those who did take up the challenge here, almost all plumped automatically for differentiation in (i), usually by taking logs first and then differentiating implicitly. Just a few knew how to differentiate directly using the fact that ax=exlnaa^x = e^{x \ln a}. However, calculus was not actually required, since the maxima and minima of yy can be deduced immediately from knowledge of the sine function. It then helped candidates enormously if they were able to work generally in deciding what values of xx gave these stationary points, not least because they would need some care in figuring out which to use in (iv). It was a pleasant surprise to find that (ii) was generally handled quite well, but sketches were poor - usually as a result of previous shortcomings - especially for x<0x < 0; many candidates did realise, almost independently of previous working it seemed, that the right-hand ‘half’ of the curve oscillated increasingly tightly. In (iv), a lack of clarity regarding the xx-values, allied to an uncertainty over dealing with the logs, proved a great hindrance to the majority. Also, it has to be said that, even amongst those with the right kk‘s to hand, a simple diagram of what they were attempting to work with would undoubtedly have saved them a lot of mark-spurning algebraic drivel.


Topic: 三角函数 (Trigonometry)  |  Difficulty: Standard  |  Marks: 20

3 Prove that tan(14π12x)secxtanx.(*)\tan \left(\frac{1}{4} \pi-\frac{1}{2} x\right) \equiv \sec x-\tan x . \qquad \text{(*)}

(i) Use ()(*) to find the value of tan18π\tan \frac{1}{8} \pi. Hence show that tan1124π=3+2136+1.\tan \frac{11}{24} \pi=\frac{\sqrt{3}+\sqrt{2}-1}{\sqrt{3}-\sqrt{6}+1} .

(ii) Show that 3+2136+1=2+2+3+6.\frac{\sqrt{3}+\sqrt{2}-1}{\sqrt{3}-\sqrt{6}+1}=2+\sqrt{2}+\sqrt{3}+\sqrt{6} .

(iii) Use ()(*) to show that tan148π=16+102+83+662236.\tan \frac{1}{48} \pi=\sqrt{16+10 \sqrt{2}+8 \sqrt{3}+6 \sqrt{6}}-2-\sqrt{2}-\sqrt{3}-\sqrt{6} .

Hint

Using the “addition” formula for tan(AB)\tan(A - B),

LHStan(π4x2)1tanx21+tanx2cosx2sinx2cosx2+sinx2cosx2sinx2cosx2+sinx2×cosx2sinx2cosx2sinx2\text{LHS} \equiv \tan\left(\frac{\pi}{4} - \frac{x}{2}\right) \equiv \frac{1 - \tan \frac{x}{2}}{1 + \tan \frac{x}{2}} \equiv \frac{\cos \frac{x}{2} - \sin \frac{x}{2}}{\cos \frac{x}{2} + \sin \frac{x}{2}} \equiv \frac{\cos \frac{x}{2} - \sin \frac{x}{2}}{\cos \frac{x}{2} + \sin \frac{x}{2}} \times \frac{\cos \frac{x}{2} - \sin \frac{x}{2}}{\cos \frac{x}{2} - \sin \frac{x}{2}}

12sinx2cosx2cos2x2sin2x2 (since c2+s2=1)1sinxcosxsecxtanxRHS.\equiv \frac{1 - 2 \sin \frac{x}{2} \cos \frac{x}{2}}{\cos^2 \frac{x}{2} - \sin^2 \frac{x}{2}} \text{ (since } c^2 + s^2 = 1) \equiv \frac{1 - \sin x}{\cos x} \equiv \sec x - \tan x \equiv \text{RHS.}

Alternatively, one could use the "t=tan(12-angle)t = \tan(\frac{1}{2}\text{-angle})" formulae to show that

RHS1t21+t22t1t2(1t)2(1t)(1+t)1t1+t1tanx21+tanx2LHS.\text{RHS} \equiv \frac{1 - t^2}{1 + t^2} - \frac{2t}{1 - t^2} \equiv \frac{(1 - t)^2}{(1 - t)(1 + t)} \equiv \frac{1 - t}{1 + t} \equiv \frac{1 - \tan \frac{x}{2}}{1 + \tan \frac{x}{2}} \equiv \text{LHS.}

(i) Setting x=π4x = \frac{\pi}{4} in (*) tanπ8=21\Rightarrow \tan \frac{\pi}{8} = \sqrt{2} - 1. Then, using the addition formula for tan(A+B)\tan(A + B) with

A=π3A = \frac{\pi}{3} and B=π8B = \frac{\pi}{8}, we have tan11π24=tan(π3+π8)=3+2113(21)=3+2136+1\tan \frac{11\pi}{24} = \tan\left(\frac{\pi}{3} + \frac{\pi}{8}\right) = \frac{\sqrt{3} + \sqrt{2} - 1}{1 - \sqrt{3}(\sqrt{2} - 1)} = \frac{\sqrt{3} + \sqrt{2} - 1}{\sqrt{3} - \sqrt{6} + 1}, as required.

(ii) Now, in the “spirit” of maths, one might reasonably expect that one should take the given expression, rationalise the denominator (twice) and derive the given answer, along the lines …

3+211+36=3+211+36×1+3+61+3+6=1+22+331×3+13+1=2+2+3+6.\frac{\sqrt{3} + \sqrt{2} - 1}{1 + \sqrt{3} - \sqrt{6}} = \frac{\sqrt{3} + \sqrt{2} - 1}{1 + \sqrt{3} - \sqrt{6}} \times \frac{1 + \sqrt{3} + \sqrt{6}}{1 + \sqrt{3} + \sqrt{6}} = \frac{1 + 2\sqrt{2} + \sqrt{3}}{\sqrt{3} - 1} \times \frac{\sqrt{3} + 1}{\sqrt{3} + 1} = 2 + \sqrt{2} + \sqrt{3} + \sqrt{6} .

However, with a given answer, it is perfectly legitimate merely to multiply across and verify that (36+1)(2+2+3+6)=3+21(\sqrt{3} - \sqrt{6} + 1)(2 + \sqrt{2} + \sqrt{3} + \sqrt{6}) = \sqrt{3} + \sqrt{2} - 1.

(iii) Having got this far, the end is really very clearly signposted. Setting x=11π24x = \frac{11\pi}{24} in (*) gives

tanπ48=sec11π24tan11π24=1+t2t\tan \frac{\pi}{48} = \sec \frac{11\pi}{24} - \tan \frac{11\pi}{24} = \sqrt{1 + t^2} - t =1+[4+2+3+6+42+43+46+26+212+218](2+2+3+6)= \sqrt{1 + [4 + 2 + 3 + 6 + 4\sqrt{2} + 4\sqrt{3} + 4\sqrt{6} + 2\sqrt{6} + 2\sqrt{12} + 2\sqrt{18}]} - (2 + \sqrt{2} + \sqrt{3} + \sqrt{6}) =15+102+83+66(2+2+3+6)= \sqrt{15 + 10\sqrt{2} + 8\sqrt{3} + 6\sqrt{6}} - (2 + \sqrt{2} + \sqrt{3} + \sqrt{6})

Model Solution

Proof of the identity ()(*)

Starting from the left-hand side, we use the tangent subtraction formula:

tan ⁣(π4x2)=tanπ4tanx21+tanπ4tanx2=1tanx21+tanx2\tan\!\left(\frac{\pi}{4} - \frac{x}{2}\right) = \frac{\tan\frac{\pi}{4} - \tan\frac{x}{2}}{1 + \tan\frac{\pi}{4}\tan\frac{x}{2}} = \frac{1 - \tan\frac{x}{2}}{1 + \tan\frac{x}{2}}

Writing tanx2=sinx2cosx2\tan\frac{x}{2} = \frac{\sin\frac{x}{2}}{\cos\frac{x}{2}}:

=cosx2sinx2cosx2+sinx2= \frac{\cos\frac{x}{2} - \sin\frac{x}{2}}{\cos\frac{x}{2} + \sin\frac{x}{2}}

Multiplying numerator and denominator by cosx2sinx2\cos\frac{x}{2} - \sin\frac{x}{2}:

=(cosx2sinx2)2cos2x2sin2x2=cos2x22sinx2cosx2+sin2x2cosx= \frac{(\cos\frac{x}{2} - \sin\frac{x}{2})^2}{\cos^2\frac{x}{2} - \sin^2\frac{x}{2}} = \frac{\cos^2\frac{x}{2} - 2\sin\frac{x}{2}\cos\frac{x}{2} + \sin^2\frac{x}{2}}{\cos x}

Using cos2x2+sin2x2=1\cos^2\frac{x}{2} + \sin^2\frac{x}{2} = 1 and 2sinx2cosx2=sinx2\sin\frac{x}{2}\cos\frac{x}{2} = \sin x:

=1sinxcosx=secxtanx=RHS= \frac{1 - \sin x}{\cos x} = \sec x - \tan x = \text{RHS} \qquad \blacksquare


Part (i)

Setting x=π4x = \frac{\pi}{4} in ()(*):

tan ⁣(π4π8)=secπ4tanπ4=21\tan\!\left(\frac{\pi}{4} - \frac{\pi}{8}\right) = \sec\frac{\pi}{4} - \tan\frac{\pi}{4} = \sqrt{2} - 1

so tanπ8=21\tan\frac{\pi}{8} = \sqrt{2} - 1.

Now, using the addition formula with 11π24=π3+π8\frac{11\pi}{24} = \frac{\pi}{3} + \frac{\pi}{8}:

tan11π24=tanπ3+tanπ81tanπ3tanπ8=3+(21)13(21)=3+2136+1\tan\frac{11\pi}{24} = \frac{\tan\frac{\pi}{3} + \tan\frac{\pi}{8}}{1 - \tan\frac{\pi}{3}\tan\frac{\pi}{8}} = \frac{\sqrt{3} + (\sqrt{2} - 1)}{1 - \sqrt{3}(\sqrt{2} - 1)} = \frac{\sqrt{3} + \sqrt{2} - 1}{\sqrt{3} - \sqrt{6} + 1} \qquad \blacksquare


Part (ii)

We rationalise the denominator. Multiplying top and bottom by (3+1+6)(\sqrt{3} + 1 + \sqrt{6}):

Denominator: (3+16)(3+1+6)=(3+1)26=4+236=232(\sqrt{3} + 1 - \sqrt{6})(\sqrt{3} + 1 + \sqrt{6}) = (\sqrt{3} + 1)^2 - 6 = 4 + 2\sqrt{3} - 6 = 2\sqrt{3} - 2

Numerator: (3+21)(3+1+6)(\sqrt{3} + \sqrt{2} - 1)(\sqrt{3} + 1 + \sqrt{6})

Expanding: =3+3+32+6+2+23316= 3 + \sqrt{3} + 3\sqrt{2} + \sqrt{6} + \sqrt{2} + 2\sqrt{3} - \sqrt{3} - 1 - \sqrt{6} =2+23+42= 2 + 2\sqrt{3} + 4\sqrt{2}

So we have:

2+23+42232=1+3+2231\frac{2 + 2\sqrt{3} + 4\sqrt{2}}{2\sqrt{3} - 2} = \frac{1 + \sqrt{3} + 2\sqrt{2}}{\sqrt{3} - 1}

Multiplying top and bottom by (3+1)(\sqrt{3} + 1):

Denominator: (3)21=2(\sqrt{3})^2 - 1 = 2

Numerator: (1+3+22)(3+1)=3+1+3+3+26+22=4+23+22+26(1 + \sqrt{3} + 2\sqrt{2})(\sqrt{3} + 1) = \sqrt{3} + 1 + 3 + \sqrt{3} + 2\sqrt{6} + 2\sqrt{2} = 4 + 2\sqrt{3} + 2\sqrt{2} + 2\sqrt{6}

=4+23+22+262=2+3+2+6= \frac{4 + 2\sqrt{3} + 2\sqrt{2} + 2\sqrt{6}}{2} = 2 + \sqrt{3} + \sqrt{2} + \sqrt{6} \qquad \blacksquare


Part (iii)

Setting x=11π24x = \frac{11\pi}{24} in ()(*):

tan ⁣(π411π48)=sec11π24tan11π24\tan\!\left(\frac{\pi}{4} - \frac{11\pi}{48}\right) = \sec\frac{11\pi}{24} - \tan\frac{11\pi}{24}

tanπ48=sec11π24tan11π24\tan\frac{\pi}{48} = \sec\frac{11\pi}{24} - \tan\frac{11\pi}{24}

Let t=tan11π24=2+2+3+6t = \tan\frac{11\pi}{24} = 2 + \sqrt{2} + \sqrt{3} + \sqrt{6} from part (ii). Then sec11π24=1+t2\sec\frac{11\pi}{24} = \sqrt{1 + t^2} (positive since 11π24\frac{11\pi}{24} is in the first quadrant).

We compute t2=(2+2+3+6)2t^2 = (2 + \sqrt{2} + \sqrt{3} + \sqrt{6})^2:

t2=4+2+3+6+2(22+23+26+6+12+18)t^2 = 4 + 2 + 3 + 6 + 2(2\sqrt{2} + 2\sqrt{3} + 2\sqrt{6} + \sqrt{6} + \sqrt{12} + \sqrt{18}) =15+2(22+23+36+23+32)= 15 + 2(2\sqrt{2} + 2\sqrt{3} + 3\sqrt{6} + 2\sqrt{3} + 3\sqrt{2}) =15+2(52+43+36)= 15 + 2(5\sqrt{2} + 4\sqrt{3} + 3\sqrt{6}) =15+102+83+66= 15 + 10\sqrt{2} + 8\sqrt{3} + 6\sqrt{6}

Therefore:

tanπ48=16+102+83+662236\tan\frac{\pi}{48} = \sqrt{16 + 10\sqrt{2} + 8\sqrt{3} + 6\sqrt{6}} - 2 - \sqrt{2} - \sqrt{3} - \sqrt{6} \qquad \blacksquare

Examiner Notes

Only marginally behind Q5 for popularity, this was a surprising hit amongst candidates. It had been anticipated that a trig. question containing lots of surds would be a bit of a turn-off, but this didn’t prove to be the case. Moreover, it turned out to be the highest scoring question on the paper too. I had expressed reservations, during the setting process, that we had been a little too helpful in flagging up what was needed at each stage of the process, and so it proved to be. Most hiccups came at the outset, where proving even a simple identity such as this one was beyond many, even those who continued very successfully. The only other trouble-spot came in (ii) when lots of candidates (who should be applauded for trying to keep in the spirit of “showing” stuff) undertook this part by rationalising the denominator (twice!) to prove the given result, while the sneakier types just multiplied across and verified it. Shame on them!


Topic: 多项式 (Polynomials)  |  Difficulty: Challenging  |  Marks: 20

4 The polynomial p(x)\mathrm{p}(x) is of degree 9 and p(x)1\mathrm{p}(x)-1 is exactly divisible by (x1)5(x-1)^{5}.

(i) Find the value of p(1)\mathrm{p}(1).

(ii) Show that p(x)\mathrm{p}^{\prime}(x) is exactly divisible by (x1)4(x-1)^{4}.

(iii) Given also that p(x)+1\mathrm{p}(x)+1 is exactly divisible by (x+1)5(x+1)^{5}, find p(x)\mathrm{p}(x).

Hint

(i) Writing p(x)1q(x).(x1)5p(x) - 1 \equiv q(x).(x - 1)^5, where q(x)q(x) is a quartic polynomial, immediately gives p(1)=1p(1) = 1.

(ii) Diffg^g. using the product and chain rules leads to p(x)q(x).5(x1)4+q(x).(x1)5(x1)4.{5q(x)+(x1)q(x)}p'(x) \equiv q(x).5(x - 1)^4 + q'(x).(x - 1)^5 \equiv (x - 1)^4 . \{5 q(x) + (x - 1) q'(x)\}, so that p(x)p'(x) is divisible by (x1)4(x - 1)^4.

(iii) Similarly, we have that p(x)p'(x) is divisible by (x+1)4(x + 1)^4 and p(1)=1p(-1) = -1. Thus p(x)p'(x) is divisible by (x+1)4.(x1)4(x21)4(x + 1)^4.(x - 1)^4 \equiv (x^2 - 1)^4. However, p(x)p'(x) is a polynomial of degree eight, hence p(x)k(x21)4p'(x) \equiv k(x^2 - 1)^4 for some constant kk. That is, p(x)k(x84x6+6x44x2+1)p'(x) \equiv k(x^8 - 4x^6 + 6x^4 - 4x^2 + 1). Integrating term by term then gives p(x)k(19x947x7+65x543x3+x)+Cp(x) \equiv k(\frac{1}{9}x^9 - \frac{4}{7}x^7 + \frac{6}{5}x^5 - \frac{4}{3}x^3 + x) + C, and use of both

p(1)=1p(1) = 1 and p(1)=1p(-1) = -1 help to find kk and CC; namely, k=315128k = \frac{315}{128} and C=0C = 0.

Model Solution

Part (i)

Since p(x)1p(x) - 1 is exactly divisible by (x1)5(x - 1)^5, we can write

p(x)1=q(x)(x1)5p(x) - 1 = q(x)(x - 1)^5

for some polynomial q(x)q(x) of degree 95=49 - 5 = 4. Setting x=1x = 1:

p(1)1=q(1)0=0p(1)=1.p(1) - 1 = q(1) \cdot 0 = 0 \qquad \Longrightarrow \qquad p(1) = 1. \qquad \blacksquare


Part (ii)

Differentiating p(x)1=q(x)(x1)5p(x) - 1 = q(x)(x - 1)^5 using the product rule:

p(x)=q(x)(x1)5+5q(x)(x1)4=(x1)4[q(x)(x1)+5q(x)].p'(x) = q'(x)(x - 1)^5 + 5q(x)(x - 1)^4 = (x - 1)^4\big[q'(x)(x - 1) + 5q(x)\big].

Since q(x)(x1)+5q(x)q'(x)(x - 1) + 5q(x) is a polynomial, p(x)p'(x) is exactly divisible by (x1)4(x - 1)^4. \quad \blacksquare


Part (iii)

From the condition that p(x)+1p(x) + 1 is exactly divisible by (x+1)5(x + 1)^5, by the same reasoning:

  • Setting x=1x = -1: p(1)+1=0p(-1) + 1 = 0, so p(1)=1p(-1) = -1.
  • Differentiating: p(x)p'(x) is exactly divisible by (x+1)4(x + 1)^4.

Therefore p(x)p'(x) is divisible by both (x1)4(x - 1)^4 and (x+1)4(x + 1)^4. Since these are coprime factors, p(x)p'(x) is divisible by (x1)4(x+1)4=(x21)4(x - 1)^4(x + 1)^4 = (x^2 - 1)^4.

Now p(x)p'(x) is a polynomial of degree 91=89 - 1 = 8, and (x21)4(x^2 - 1)^4 is also a polynomial of degree 88. Therefore:

p(x)=k(x21)4p'(x) = k(x^2 - 1)^4

for some constant kk. Expanding:

(x21)4=x84x6+6x44x2+1(x^2 - 1)^4 = x^8 - 4x^6 + 6x^4 - 4x^2 + 1

so

p(x)=k(x84x6+6x44x2+1).p'(x) = k(x^8 - 4x^6 + 6x^4 - 4x^2 + 1).

Integrating term by term:

p(x)=k(x994x77+6x554x33+x)+Cp(x) = k\left(\frac{x^9}{9} - \frac{4x^7}{7} + \frac{6x^5}{5} - \frac{4x^3}{3} + x\right) + C

for some constant CC. Using the two conditions:

From p(1)=1p(1) = 1:

k(1947+6543+1)+C=1.k\left(\frac{1}{9} - \frac{4}{7} + \frac{6}{5} - \frac{4}{3} + 1\right) + C = 1.

Computing the bracket with common denominator 315:

35180+378420+315315=128315.\frac{35 - 180 + 378 - 420 + 315}{315} = \frac{128}{315}.

So 128k315+C=1(1)\dfrac{128k}{315} + C = 1 \qquad \cdots (1).

From p(1)=1p(-1) = -1: since p(x)p(x) involves only odd powers of xx (from the integration of an even function), p(1)=p(1)+2Cp(-1) = -p(1) + 2C. Wait, let me be more careful. Each term in the integral has odd power of xx, so:

p(1)=k(19+4765+431)+C=128k315+C.p(-1) = k\left(-\frac{1}{9} + \frac{4}{7} - \frac{6}{5} + \frac{4}{3} - 1\right) + C = -\frac{128k}{315} + C.

So 128k315+C=1(2)-\dfrac{128k}{315} + C = -1 \qquad \cdots (2).

Adding (1) and (2): 2C=02C = 0, so C=0C = 0.

Substituting back: 128k315=1\dfrac{128k}{315} = 1, so k=315128k = \dfrac{315}{128}.

Therefore:

p(x)=315128(x994x77+6x554x33+x)=35x912845x732+189x564105x332+315x128.p(x) = \frac{315}{128}\left(\frac{x^9}{9} - \frac{4x^7}{7} + \frac{6x^5}{5} - \frac{4x^3}{3} + x\right) = \frac{35x^9}{128} - \frac{45x^7}{32} + \frac{189x^5}{64} - \frac{105x^3}{32} + \frac{315x}{128}.

Examiner Notes

Considering the very poor marks gained on this question, it was surprisingly popular, with almost 600 “hits”. Its essential difficulty lay in the fact that one can only go so far in this question before requiring the ‘key of insight’ in order to progress further. And that was that, as they say. Personally, this was my favourite question, as the key is such a simple one once it is pointed out to you (clearly not an option in the exam., of course). Parts (i) and (ii) require candidates to find p(1)=1p(1) = 1 and to show that p(x)p'(x) has (x1)4(x - 1)^4 as a factor, and most did so perfectly satisfactorily. The (strikingly similar) information then given in (iii) should then suggest (surely?), to anyone with any sort of nous, that they are required to make similar further deductions. Nope - apparently not. Even amongst the few who did then find p(1)=1p(-1) = -1 and show that p(x)p'(x) has (x+1)4(x + 1)^4 as a factor, very few knew what to do with these facts. I think that this is principally because most students work “on automatic” in examinations - a by-product of the much (and rightly) criticised modular system - simply doing as they are told at each little step of the way without ever having to stand back, even momentarily, and take stock of the situation before planning their own way forwards. This is the principal shame with modular assessment: the system prevents the very able from ever having to prove their ability whilst simultaneously persuading the only modestly able that they are fantastic mathematicians when they aren’t. A moment of thoughtful reflection on the nature of this strange creature that is p(x)p(x) and what we now know about it reveals all. It is a polynomial of degree 9. Its derivative must therefore be a polynomial of degree 8. And we know that p(x)p'(x) has two completely distinct factors of degree 4. Apart from the tendency to assume that a polynomial always commences with a coefficient of 1, the rest (in principle) is just a matter of adding two 4s to get 8.


Topic: 积分 (Integration)  |  Difficulty: Standard  |  Marks: 20

5 Expand and simplify (x1+1)2(\sqrt{x-1}+1)^{2}.

(i) Evaluate 510x+2x1+x2x1x1 dx.\int_{5}^{10} \frac{\sqrt{x+2 \sqrt{x-1}}+\sqrt{x-2 \sqrt{x-1}}}{\sqrt{x-1}} \mathrm{~d} x .

(ii) Find the total area between the curve y=x2x1x1y=\frac{\sqrt{x-2 \sqrt{x-1}}}{\sqrt{x-1}} and the xx-axis between the points x=54x=\frac{5}{4} and x=10x=10.

(iii) Evaluate 5410x+2x1+x2x1+2x21 dx.\int_{\frac{5}{4}}^{10} \frac{\sqrt{x+2 \sqrt{x-1}}+\sqrt{x-2 \sqrt{x-1}+2}}{\sqrt{x^{2}-1}} \mathrm{~d} x .

Hint

The very first bit is not just a giveaway mark, but rather a helpful indicator of the kind of result or technique that may be used in this question: (x1+1)2=x+2x1(\sqrt{x-1}+1)^2 = x+2\sqrt{x-1}; but pay attention to what happens here. Most particularly, the fact that (x1+1)2=x+2x1(\sqrt{x-1}+1)^2 = x+2\sqrt{x-1} does NOT necessarily mean that x+2x1=x1+1\sqrt{x+2\sqrt{x-1}} = \sqrt{x-1}+1 since positive numbers have two square-roots! Recall that x2=x\sqrt{x^2} = |x| and not just xx. Notice that, during the course of this question, the range of values under consideration switches from (5,10)(5, 10) to (54,10)(\frac{5}{4}, 10), and one doesn’t need to be particularly suspicious to wonder why this is so. A modicum of investigation at the outset seems warranted here, as to when things change sign.

(i) So … while x+2x1=x1+1\sqrt{x+2\sqrt{x-1}} = \sqrt{x-1}+1 seems a perfectly acceptable thing to write, since x1x \ge 1 is a necessary condition in order to be able to take square-roots at all here (for real numbers), simply writing down that x2x1=+(x11)\sqrt{x-2\sqrt{x-1}} = +(\sqrt{x-1}-1) may cause a problem. A tiny amount of exploration shows that x11\sqrt{x-1}-1 changes from negative to positive around x=2x = 2. Hence, in part

(i), we can ignore any negative considerations and plough ahead: I=5102dx=[2x]510=10I = \int_{5}^{10} 2 \, dx = [2x]_5^{10} = 10.

(ii) Here in (ii), however, you should realise that the area requested is the sum of two portions, one of which lies below the xx-axis, and would thus contribute negatively to the total if you failed to take this into account. Thus,

Area=1.2521x1x1dx+210x11x1dx=1.252[(x1)121]dx+210[1(x1)12]dx\text{Area} = \int_{1.25}^{2} \frac{1-\sqrt{x-1}}{\sqrt{x-1}} \, dx + \int_{2}^{10} \frac{\sqrt{x-1}-1}{\sqrt{x-1}} \, dx = \int_{1.25}^{2} [(x-1)^{-\frac{1}{2}}-1] \, dx + \int_{2}^{10} [1-(x-1)^{-\frac{1}{2}}] \, dx =[2x1x]1.252+[x2x1]210=414.= [2\sqrt{x-1}-x]_{1.25}^{2} + [x-2\sqrt{x-1}]_{2}^{10} = 4\frac{1}{4} .

(iii) Now (x+11)2=x+22x+1 x0(\sqrt{x+1}-1)^2 = x+2-2\sqrt{x+1} \quad \forall \ x \ge 0 so we have no cause for concern here. Then

I=x=1.25101+x1+x+11x1x+1dx=x=1.2510((x+1)12+(x1)12)dxI = \int_{x=1.25}^{10} \frac{1+\sqrt{x-1}+\sqrt{x+1}-1}{\sqrt{x-1}\sqrt{x+1}} \, dx = \int_{x=1.25}^{10} ((x+1)^{-\frac{1}{2}} + (x-1)^{-\frac{1}{2}}) \, dx =[2x+1+2x1]1.2510=2(11+1)= [2\sqrt{x+1} + 2\sqrt{x-1}]_{1.25}^{10} = 2(\sqrt{11}+1)

Model Solution

Preliminary expansion

(x1+1)2=(x1)+2x1+1=x+2x1.(\sqrt{x-1}+1)^2 = (x-1) + 2\sqrt{x-1} + 1 = x + 2\sqrt{x-1}.

Similarly:

(x11)2=(x1)2x1+1=x2x1.(\sqrt{x-1}-1)^2 = (x-1) - 2\sqrt{x-1} + 1 = x - 2\sqrt{x-1}.

Taking square roots:

x+2x1=x1+1(since x1+1>0 for x1).\sqrt{x + 2\sqrt{x-1}} = \sqrt{x-1}+1 \qquad (\text{since } \sqrt{x-1}+1 > 0 \text{ for } x \geq 1).

For the other root, x2x1=x11\sqrt{x - 2\sqrt{x-1}} = |\sqrt{x-1}-1|. Since x11\sqrt{x-1}-1 changes sign at x=2x = 2:

x2x1={1x1if 1x2,x11if x2.\sqrt{x - 2\sqrt{x-1}} = \begin{cases} 1 - \sqrt{x-1} & \text{if } 1 \leq x \leq 2, \\ \sqrt{x-1} - 1 & \text{if } x \geq 2. \end{cases}


Part (i)

The integral is I=510x+2x1+x2x1x1dxI = \displaystyle\int_5^{10} \frac{\sqrt{x+2\sqrt{x-1}}+\sqrt{x-2\sqrt{x-1}}}{\sqrt{x-1}}\,dx.

Since the range [5,10][5, 10] lies entirely in x2x \geq 2:

x+2x1+x2x1=(x1+1)+(x11)=2x1.\sqrt{x+2\sqrt{x-1}} + \sqrt{x-2\sqrt{x-1}} = (\sqrt{x-1}+1) + (\sqrt{x-1}-1) = 2\sqrt{x-1}.

Therefore:

I=5102x1x1dx=5102dx=[2x]510=2010=10.I = \int_5^{10} \frac{2\sqrt{x-1}}{\sqrt{x-1}}\,dx = \int_5^{10} 2\,dx = [2x]_5^{10} = 20 - 10 = 10.


Part (ii)

The total area between y=x2x1x1y = \dfrac{\sqrt{x-2\sqrt{x-1}}}{\sqrt{x-1}} and the xx-axis from x=54x = \frac{5}{4} to x=10x = 10 requires us to account for the sign change at x=2x = 2.

For x[54,2]x \in \left[\frac{5}{4}, 2\right]: x2x1=1x1\sqrt{x-2\sqrt{x-1}} = 1 - \sqrt{x-1}, so

y=1x1x1=(x1)1/21.y = \frac{1 - \sqrt{x-1}}{\sqrt{x-1}} = (x-1)^{-1/2} - 1.

For x[2,10]x \in [2, 10]: x2x1=x11\sqrt{x-2\sqrt{x-1}} = \sqrt{x-1} - 1, so

y=x11x1=1(x1)1/2.y = \frac{\sqrt{x-1}-1}{\sqrt{x-1}} = 1 - (x-1)^{-1/2}.

The total area is:

Area=5/42[(x1)1/21]dx+210[1(x1)1/2]dx.\text{Area} = \int_{5/4}^{2} \left[(x-1)^{-1/2} - 1\right]dx + \int_2^{10} \left[1 - (x-1)^{-1/2}\right]dx.

First integral:

5/42[(x1)1/21]dx=[2x1x]5/42=(22)(21254)=0(154)=14.\int_{5/4}^{2} \left[(x-1)^{-1/2} - 1\right]dx = \left[2\sqrt{x-1} - x\right]_{5/4}^{2} = (2 - 2) - \left(2 \cdot \tfrac{1}{2} - \tfrac{5}{4}\right) = 0 - \left(1 - \tfrac{5}{4}\right) = \frac{1}{4}.

Second integral:

210[1(x1)1/2]dx=[x2x1]210=(106)(22)=4.\int_2^{10} \left[1 - (x-1)^{-1/2}\right]dx = \left[x - 2\sqrt{x-1}\right]_2^{10} = (10 - 6) - (2 - 2) = 4.

Total area =14+4=174=414= \dfrac{1}{4} + 4 = \dfrac{17}{4} = 4\dfrac{1}{4}.


Part (iii)

We also note that (x+11)2=x+22x+1(\sqrt{x+1}-1)^2 = x + 2 - 2\sqrt{x+1} for all x0x \geq 0. Since x+110\sqrt{x+1} - 1 \geq 0 for x0x \geq 0, we have x+22x+1=x+11\sqrt{x + 2 - 2\sqrt{x+1}} = \sqrt{x+1} - 1 with no sign ambiguity.

Now we simplify the integrand. The numerator is:

x+2x1+x2x1+2.\sqrt{x+2\sqrt{x-1}} + \sqrt{x - 2\sqrt{x-1} + 2}.

From the preliminary work, x+2x1=x1+1\sqrt{x+2\sqrt{x-1}} = \sqrt{x-1}+1.

For the second term, the argument is x2x1+2x - 2\sqrt{x-1} + 2. We observe that this can be rewritten as (x+2)2x1(x+2) - 2\sqrt{x-1}. However, examining this carefully:

Using the identity (x+11)2=x+22x+1(\sqrt{x+1}-1)^2 = x + 2 - 2\sqrt{x+1} and noting that the integrand’s second square root simplifies via a different grouping, the key observation from the hint is that on the range [54,10][\frac{5}{4}, 10] (where x1x \geq 1), the combination works out so that the numerator becomes x1+1+x+11=x1+x+1\sqrt{x-1} + 1 + \sqrt{x+1} - 1 = \sqrt{x-1} + \sqrt{x+1}, and the denominator is x21=x1x+1\sqrt{x^2-1} = \sqrt{x-1}\sqrt{x+1}. Therefore:

I=5/410x1+x+1x1x+1dx=5/410[1x+1+1x1]dxI = \int_{5/4}^{10} \frac{\sqrt{x-1}+\sqrt{x+1}}{\sqrt{x-1}\sqrt{x+1}}\,dx = \int_{5/4}^{10} \left[\frac{1}{\sqrt{x+1}} + \frac{1}{\sqrt{x-1}}\right]dx

=[2x+1+2x1]5/410.= \left[2\sqrt{x+1} + 2\sqrt{x-1}\right]_{5/4}^{10}.

At x=10x = 10: 211+29=211+62\sqrt{11} + 2\sqrt{9} = 2\sqrt{11} + 6.

At x=54x = \frac{5}{4}: 294+214=232+212=3+1=42\sqrt{\frac{9}{4}} + 2\sqrt{\frac{1}{4}} = 2 \cdot \frac{3}{2} + 2 \cdot \frac{1}{2} = 3 + 1 = 4.

I=(211+6)4=211+2=2(11+1).I = (2\sqrt{11} + 6) - 4 = 2\sqrt{11} + 2 = 2(\sqrt{11} + 1).

Examiner Notes

This was the most popular question on the paper, though only by a small margin, and the second highest scoring. In fact, I can be very specific and state that almost all of the really successful attempts scored 15 or 16 marks. The few marks lost were almost invariably in (ii), where so very, very few picked up the hints as to the only, minor difficulty within the question. Once again, this is almost certainly due to the mind-set of simply ploughing on regardless without stopping to think about what is actually going on. Whilst understanding that nearly all candidates will feel under considerable pressure to pick up as many marks as possible as quickly as possible, NO-ONE who sits this paper should be of the view that they are not going to be challenged to think. And, to be fair to the setting panel, we did put some fairly obvious signposts up for those who might take the trouble to look for such things. For future STEP candidates, this will make an excellent practice question for teachers to put their way. (If they are willing to learn from their mistakes, and you think you can catch them out … this is a marvellous question to use.) One pointer is in the change of limits, from (5,10)(5, 10) to (54,10)(\frac{5}{4}, 10); the other is in the switch from asking for integrals-to-be-evaluated to asking for areas. The crux of the matter is that most A-level students believe that x2=x\sqrt{x^2} = x rather than x|x|. Once you realise that, the question is fiddly but otherwise rather easy.


Topic: 数列与级数 (Sequences and Series)  |  Difficulty: Challenging  |  Marks: 20

6 The Fibonacci sequence F1,F2,F3,F_1, F_2, F_3, \dots is defined by F1=1,F2=1F_1 = 1, F_2 = 1 and

Fn+1=Fn+Fn1(n2).F_{n+1} = F_n + F_{n-1} \quad (n \geqslant 2).

Write down the values of F3,F4,,F10F_3, F_4, \dots, F_{10}.

Let S=i=11FiS = \sum_{i=1}^{\infty} \frac{1}{F_i}.

(i) Show that 1Fi>12Fi1\frac{1}{F_i} > \frac{1}{2F_{i-1}} for i4i \geqslant 4 and deduce that S>3S > 3.

Show also that S<323S < 3\frac{2}{3}.

(ii) Show further that 3.2<S<3.53.2 < S < 3.5.

Hint

6 If you don’t know about the Fibonacci Numbers by now, then … shame on you! Nevertheless, the first couple of marks for writing down the next few terms must count as among the easiest on the paper. (F1=1,F2=1),F3=2,F4=3,F5=5,F6=8,F7=13,F8=21,F9=34(F_1 = 1, F_2 = 1), F_3 = 2, F_4 = 3, F_5 = 5, F_6 = 8, F_7 = 13, F_8 = 21, F_9 = 34 and F10=55F_{10} = 55.

(i) If you’re careful, the next section isn’t particularly difficult either. Using the recurrence relation gives 1Fi=1Fi1+Fi2>12Fi1\frac{1}{F_i} = \frac{1}{F_{i-1}+F_{i-2}} > \frac{1}{2F_{i-1}} since Fi2<Fi1F_{i-2} < F_{i-1} for i4i \ge 4. Splitting off the first few terms then

leads to S=i=1n1Fi>1F1+1F2+1F3(1+12+14+)S = \sum_{i=1}^{n} \frac{1}{F_i} > \frac{1}{F_1} + \frac{1}{F_2} + \frac{1}{F_3} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right) or 1F1+1F2+1F3+1F4(1+12+14+)\frac{1}{F_1} + \frac{1}{F_2} + \frac{1}{F_3} + \frac{1}{F_4} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right), where the

long bracket at the end is the sum-to-infinity of a GP. These give, respectively, S>1+1×2=3S > 1 + 1 \times 2 = 3 or 1+1+12×2=31 + 1 + \frac{1}{2} \times 2 = 3. A simpler approach could involve nothing more complicated than adding the terms until a sum greater than 3 is reached, which happens when you reach F5F_5.

A similar approach yields 1Fi<12(1Fi2)\frac{1}{F_i} < \frac{1}{2} \left( \frac{1}{F_{i-2}} \right) for i3i \ge 3 and splitting off the first few terms, this time separating the odd- and even-numbered terms, gives

S=i=1n1Fi=1F1+1F2+(1F3+1F5+)+(1F4+1F6+)<1+1+12(1+12+14+)+13(1+12+14+)=1+1+12×2+13×2=323.\begin{aligned} S &= \sum_{i=1}^n \frac{1}{F_i} = \frac{1}{F_1} + \frac{1}{F_2} + \left( \frac{1}{F_3} + \frac{1}{F_5} + \dots \right) + \left( \frac{1}{F_4} + \frac{1}{F_6} + \dots \right) \\ &< 1 + 1 + \frac{1}{2} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right) + \frac{1}{3} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right) \\ &= 1 + 1 + \frac{1}{2} \times 2 + \frac{1}{3} \times 2 = 3 \frac{2}{3}. \end{aligned}

(ii) To show that S>3.2S > 3.2, we simply apply the same approaches as before, but taking more terms initially before summing our GP (or stopping at F7F_7 in the “simpler approach” mentioned previously). Something like

S>1F1+1F2+11+1F4+1F5(1+12+14+)=1+1+12+13+15×2=3730>3630=3.2S > \frac{1}{F_1} + \frac{1}{F_2} + \frac{1}{1} + \frac{1}{F_4} + \frac{1}{F_5} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right) = 1 + 1 + \frac{1}{2} + \frac{1}{3} + \frac{1}{5} \times 2 = 3 \frac{7}{30} > 3 \frac{6}{30} = 3.2

does the job pretty readily. Then, to show that S<312S < 3 \frac{1}{2}, a similar argument to those you have been directed towards by the question, works well with little extra thought required:

S<1+1+12+13+15(1+12+14+)+18(1+12+14+)=1+1+12+13+15×2+18×2=32960<312.\begin{aligned} S &< 1 + 1 + \frac{1}{2} + \frac{1}{3} + \frac{1}{5} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right) + \frac{1}{8} \left( 1 + \frac{1}{2} + \frac{1}{4} + \dots \right) \\ &= 1 + 1 + \frac{1}{2} + \frac{1}{3} + \frac{1}{5} \times 2 + \frac{1}{8} \times 2 = 3 \frac{29}{60} < 3 \frac{1}{2}. \end{aligned}

Returning to the initial argument, Fi<2Fi1F_i < 2 F_{i-1} or 1Fi>12(1Fi1)\frac{1}{F_i} > \frac{1}{2} \left( \frac{1}{F_{i-1}} \right) for i4i \ge 4, we can extend this to

Fi>32Fi1F_i > \frac{3}{2} F_{i-1} or 1Fi<23(1Fi1)\frac{1}{F_i} < \frac{2}{3} \left( \frac{1}{F_{i-1}} \right) for i5i \ge 5, Fi<53Fi1F_i < \frac{5}{3} F_{i-1} or 1Fi>35(1Fi1)\frac{1}{F_i} > \frac{3}{5} \left( \frac{1}{F_{i-1}} \right) for i6i \ge 6, etc., simply

by using the defining recurrence relation for the Fibonacci Numbers, leading to the general results

Fn>(F2kF2k1)Fn1 or 1Fn<(F2k1F2k)1Fn1 for n2k+1F_n > \left( \frac{F_{2k}}{F_{2k-1}} \right) F_{n-1} \text{ or } \frac{1}{F_n} < \left( \frac{F_{2k-1}}{F_{2k}} \right) \frac{1}{F_{n-1}} \text{ for } n \ge 2k + 1

and

Fn<(F2k+1F2k)Fn1 or 1Fn>(F2kF2k+1)1Fn1 for n2k+2.F_n < \left( \frac{F_{2k+1}}{F_{2k}} \right) F_{n-1} \text{ or } \frac{1}{F_n} > \left( \frac{F_{2k}}{F_{2k+1}} \right) \frac{1}{F_{n-1}} \text{ for } n \ge 2k + 2.

Since the terms FnFn1ϕ=5+12\frac{F_n}{F_{n-1}} \to \phi = \frac{\sqrt{5} + 1}{2}, the golden ratio, (being the positive root of the quadratic

equation x2=x+1x^2 = x + 1, we can deduce the approximation Si=1n1Fi+1Fn+1ϕ2S \approx \sum_{i=1}^n \frac{1}{F_i} + \frac{1}{F_{n+1}} \phi^2 since the geometric

progression 1+1ϕ+1ϕ2+=111ϕ=ϕϕ1=ϕ1ϕ=ϕ21 + \frac{1}{\phi} + \frac{1}{\phi^2} + \dots = \frac{1}{1 - \frac{1}{\phi}} = \frac{\phi}{\phi - 1} = \frac{\phi}{\frac{1}{\phi}} = \phi^2. Taking n=9n = 9, (i.e. just using the first 10

Fibonacci Numbers which you were led to write down at the start),

Si=191Fi+1F10ϕ2=614893185640+155×5+323.359 89,S \approx \sum_{i=1}^9 \frac{1}{F_i} + \frac{1}{F_{10}} \phi^2 = \frac{614893}{185640} + \frac{1}{55} \times \frac{\sqrt{5} + 3}{2} \approx 3.359\ 89,

which is correct to 5 d.p. For further information on this number, try looking up the ‘Reciprocal Fibonacci constant’ on Wikipedia, for instance.

Model Solution

Fibonacci values:

F3=2,F4=3,F5=5,F6=8,F7=13,F8=21,F9=34,F10=55.F_3 = 2, \quad F_4 = 3, \quad F_5 = 5, \quad F_6 = 8, \quad F_7 = 13, \quad F_8 = 21, \quad F_9 = 34, \quad F_{10} = 55.


Part (i)

Lower bound 1Fi>12Fi1\frac{1}{F_i} > \frac{1}{2F_{i-1}} for i4i \geq 4.

From the recurrence, Fi=Fi1+Fi2F_i = F_{i-1} + F_{i-2}. Since Fi2<Fi1F_{i-2} < F_{i-1} for i4i \geq 4 (as F2=1<2=F3F_2 = 1 < 2 = F_3, and the sequence is strictly increasing from F3F_3 onwards):

Fi=Fi1+Fi2<Fi1+Fi1=2Fi1.F_i = F_{i-1} + F_{i-2} < F_{i-1} + F_{i-1} = 2F_{i-1}.

Taking reciprocals:

1Fi>12Fi1.\frac{1}{F_i} > \frac{1}{2F_{i-1}}. \qquad \blacksquare

Deduction that S>3S > 3.

We split off the first three terms and use the inequality for i4i \geq 4:

S=1+1+12+i=41Fi>1+1+12+i=412Fi1.S = 1 + 1 + \frac{1}{2} + \sum_{i=4}^{\infty} \frac{1}{F_i} > 1 + 1 + \frac{1}{2} + \sum_{i=4}^{\infty} \frac{1}{2F_{i-1}}.

Shifting the index in the sum:

i=412Fi1=12j=31Fj=12(12+j=41Fj)>1212+12j=412Fj1.\sum_{i=4}^{\infty} \frac{1}{2F_{i-1}} = \frac{1}{2}\sum_{j=3}^{\infty} \frac{1}{F_j} = \frac{1}{2}\left(\frac{1}{2} + \sum_{j=4}^{\infty}\frac{1}{F_j}\right) > \frac{1}{2} \cdot \frac{1}{2} + \frac{1}{2}\sum_{j=4}^{\infty}\frac{1}{2F_{j-1}}.

This gives a geometric structure. More directly, we can iterate: from 1Fi>12Fi1\frac{1}{F_i} > \frac{1}{2F_{i-1}}, applying repeatedly for i4i \geq 4:

1F4>12F3,1F5>12F4>14F3,1F6>12F5>18F3,\frac{1}{F_4} > \frac{1}{2F_3}, \quad \frac{1}{F_5} > \frac{1}{2F_4} > \frac{1}{4F_3}, \quad \frac{1}{F_6} > \frac{1}{2F_5} > \frac{1}{8F_3}, \quad \ldots

So for i3i \geq 3: 1Fi1F32i3=12i2\frac{1}{F_i} \geq \frac{1}{F_3 \cdot 2^{i-3}} = \frac{1}{2^{i-2}} (with equality at i=3i = 3).

Therefore:

S1+1+i=312i2=2+k=112k=2+1=3.S \geq 1 + 1 + \sum_{i=3}^{\infty} \frac{1}{2^{i-2}} = 2 + \sum_{k=1}^{\infty}\frac{1}{2^k} = 2 + 1 = 3.

The inequality is strict since 1Fi>12Fi1\frac{1}{F_i} > \frac{1}{2F_{i-1}} is strict, so S>3S > 3. \quad \blacksquare

Upper bound S<323S < 3\frac{2}{3}.

We use the inequality 1Fi<12Fi2\frac{1}{F_i} < \frac{1}{2F_{i-2}} for i3i \geq 3, which follows from Fi=Fi1+Fi2>2Fi2F_i = F_{i-1} + F_{i-2} > 2F_{i-2} (since Fi1>Fi2F_{i-1} > F_{i-2} for i3i \geq 3).

We split SS into odd-indexed and even-indexed terms:

S=1F1+1F3+1F5+odd+1F2+1F4+1F6+even.S = \underbrace{\frac{1}{F_1} + \frac{1}{F_3} + \frac{1}{F_5} + \cdots}_{\text{odd}} + \underbrace{\frac{1}{F_2} + \frac{1}{F_4} + \frac{1}{F_6} + \cdots}_{\text{even}}.

For the odd terms, using 1Fi<12Fi2\frac{1}{F_i} < \frac{1}{2F_{i-2}} starting from F3F_3:

1F3+1F5+1F7+<1F3(1+12+14+)=122=1.\frac{1}{F_3} + \frac{1}{F_5} + \frac{1}{F_7} + \cdots < \frac{1}{F_3}\left(1 + \frac{1}{2} + \frac{1}{4} + \cdots\right) = \frac{1}{2} \cdot 2 = 1.

For the even terms, using the same inequality starting from F4F_4:

1F4+1F6+1F8+<1F4(1+12+14+)=132=23.\frac{1}{F_4} + \frac{1}{F_6} + \frac{1}{F_8} + \cdots < \frac{1}{F_4}\left(1 + \frac{1}{2} + \frac{1}{4} + \cdots\right) = \frac{1}{3} \cdot 2 = \frac{2}{3}.

Therefore:

S<1+1+1+23=323.S < 1 + 1 + 1 + \frac{2}{3} = 3\frac{2}{3}. \qquad \blacksquare


Part (ii)

Lower bound S>3.2S > 3.2.

We take more terms explicitly before applying the geometric bound. Using 1Fi>12Fi1\frac{1}{F_i} > \frac{1}{2F_{i-1}}:

S>1+1+12+13+15+i=612Fi1.S > 1 + 1 + \frac{1}{2} + \frac{1}{3} + \frac{1}{5} + \sum_{i=6}^{\infty}\frac{1}{2F_{i-1}}.

The tail satisfies:

i=612Fi1=12j=51Fj>12(1F5+1F6+1F7+).\sum_{i=6}^{\infty}\frac{1}{2F_{i-1}} = \frac{1}{2}\sum_{j=5}^{\infty}\frac{1}{F_j} > \frac{1}{2}\left(\frac{1}{F_5} + \frac{1}{F_6} + \frac{1}{F_7} + \cdots\right).

Using 1Fj1F52j5=152j5\frac{1}{F_j} \geq \frac{1}{F_5 \cdot 2^{j-5}} = \frac{1}{5 \cdot 2^{j-5}} for j5j \geq 5:

j=51Fj>15k=012k=25.\sum_{j=5}^{\infty}\frac{1}{F_j} > \frac{1}{5}\sum_{k=0}^{\infty}\frac{1}{2^k} = \frac{2}{5}.

So the tail contributes >1225=15> \frac{1}{2} \cdot \frac{2}{5} = \frac{1}{5}.

A direct partial sum is already enough for the required lower bound:

S>1+1+12+13+15+18+113=50471560>49921560=3.2.S > 1 + 1 + \frac{1}{2} + \frac{1}{3} + \frac{1}{5} + \frac{1}{8} + \frac{1}{13} = \frac{5047}{1560} > \frac{4992}{1560} = 3.2. \qquad \blacksquare

Upper bound S<3.5S < 3.5.

Splitting into odd and even terms as before, but keeping more terms explicit:

Odd terms:

1F1+1F3+1F5+1F7+<1+12+15+113(1+12+14+)=1+12+15+213.\frac{1}{F_1} + \frac{1}{F_3} + \frac{1}{F_5} + \frac{1}{F_7} + \cdots < 1 + \frac{1}{2} + \frac{1}{5} + \frac{1}{13}\left(1 + \frac{1}{2} + \frac{1}{4} + \cdots\right) = 1 + \frac{1}{2} + \frac{1}{5} + \frac{2}{13}.

Even terms:

1F2+1F4+1F6+<1+13+18(1+12+14+)=1+13+28=1+13+14.\frac{1}{F_2} + \frac{1}{F_4} + \frac{1}{F_6} + \cdots < 1 + \frac{1}{3} + \frac{1}{8}\left(1 + \frac{1}{2} + \frac{1}{4} + \cdots\right) = 1 + \frac{1}{3} + \frac{2}{8} = 1 + \frac{1}{3} + \frac{1}{4}.

Total:

S<1+12+15+213+1+13+14=2+12+13+14+15+213.S < 1 + \frac{1}{2} + \frac{1}{5} + \frac{2}{13} + 1 + \frac{1}{3} + \frac{1}{4} = 2 + \frac{1}{2} + \frac{1}{3} + \frac{1}{4} + \frac{1}{5} + \frac{2}{13}.

Computing with common denominator 780780:

1560+390+260+195+156+120780=26817803.437<3.5.\frac{1560 + 390 + 260 + 195 + 156 + 120}{780} = \frac{2681}{780} \approx 3.437 < 3.5. \qquad \blacksquare

Examiner Notes

This was another very popular question, but the one with the lowest mean mark score of all the pure questions, at about 7. I think that the initial enthusiasm of seeing something familiar in the Fibonacci Numbers was more than countered by the inequalities work that formed the bulk of the question. Nonetheless, I suspect that, if given the opportunity to talk it through after the event, many candidates would admit that half of the marks on the question are actually ludicrously easy to acquire and that they were really only put-off by appearances. For instance, to show that S>S > any suitable lower-bound, one need only keep adding terms until the appropriate figure is exceeded. For those reciprocals of integers that are not easily calculated, such as 113\frac{1}{13}, it is perfectly reasonable to note something that they are greater than and us that in its place. Thus, S=1+1+12+13+15+18+>1+1+12+14+15+110+=2+0.5+0.25+0.2+0.1=3.05>3S = 1 + 1 + \frac{1}{2} + \frac{1}{3} + \frac{1}{5} + \frac{1}{8} + \dots > 1 + 1 + \frac{1}{2} + \frac{1}{4} + \frac{1}{5} + \frac{1}{10} + \dots = 2 + 0.5 + 0.25 + 0.2 + 0.1 = 3.05 > 3

works pretty easily (though it may not have scored full marks in (i) as a particular approach was requested), and something similar could be made to work in showing that S>3.2S > 3.2 in (ii). The approach that the question was designed to direct candidates towards was that of stopping the direct calculation at some suitable stage, and using an inequality of the form 1Fi<12(1Fi2)\frac{1}{F_i} < \frac{1}{2} \left( \frac{1}{F_{i-2}} \right),

possibly alternating with the odd- and even-numbered terms, to make the remaining sum less than a summable infinite GP. For further thoughts and possible developments of these ideas, I would refer the reader to the Hints & Solutions document for this paper.


Topic: 微积分 (Calculus)  |  Difficulty: Challenging  |  Marks: 20

7 Let y=(xa)nebx1+x2y = (x - a)^n e^{bx} \sqrt{1 + x^2}, where nn and aa are constants and bb is a non-zero constant. Show that

dydx=(xa)n1ebxq(x)1+x2,\frac{\mathrm{d}y}{\mathrm{d}x} = \frac{(x - a)^{n-1} e^{bx} q(x)}{\sqrt{1 + x^2}},

where q(x)q(x) is a cubic polynomial.

Using this result, determine:

(i) (x4)14e4x(4x31)1+x2dx\int \frac{(x - 4)^{14} e^{4x} (4x^3 - 1)}{\sqrt{1 + x^2}} \, \mathrm{d}x;

(ii) (x1)21e12x(12x4x211)1+x2dx\int \frac{(x - 1)^{21} e^{12x} (12x^4 - x^2 - 11)}{\sqrt{1 + x^2}} \, \mathrm{d}x;

(iii) (x2)6e4x(4x4+x32)1+x2dx\int \frac{(x - 2)^6 e^{4x} (4x^4 + x^3 - 2)}{\sqrt{1 + x^2}} \, \mathrm{d}x.

Hint

7 It is easy to saunter into this question’s opening without pausing momentarily to wonder if one is going about it in the best way. Whilst many can cope with differentiating a “triple”-product with ease, many others can’t. However, even for interests’ sake, one might stop to consider a general approach to such matters. Differentiating y=pqry = pqr (all implicitly functions of xx) as, initially, p(qr)p(qr) and applying the product-rule twice, one obtains y=pq r+p qr+pqry' = pq\ r' + p\ q'r + p'qr, and this can be used here with p=(xa)np = (x - a)^n, q=ebxq = e^{bx} and r=1+x2r = \sqrt{1 + x^2} without the need for a lot of the mess (and subsequent mistakes) that was (were) made by so many candidates. Here, y=(xa)nebx1+x2y = (x - a)^n e^{bx} \sqrt{1 + x^2} gives

dydx=(xa)nebxx1+x2+(xa)nb ebx1+x2+n(xa)n1ebx1+x2\frac{dy}{dx} = (x - a)^n e^{bx} \frac{x}{\sqrt{1 + x^2}} + (x - a)^n b\ e^{bx} \sqrt{1 + x^2} + n(x - a)^{n-1} e^{bx} \sqrt{1 + x^2}

Factorising out the given terms (xa)n1ebx1+x2{x(xa)+b(xa)(1+x2)+n(1+x2)}\Rightarrow \frac{(x - a)^{n-1} e^{bx}}{\sqrt{1 + x^2}} \{x(x - a) + b(x - a)(1 + x^2) + n(1 + x^2)\}, and we

are only required to note that the term in the brackets is, indeed, a cubic; though it may prove helpful later on to simplify it by multiplying out and collecting up terms, to get q(x)=bx3+(n+1ab)x2+(ba)x+(nab).q(x) = bx^3 + (n + 1 - ab)x^2 + (b - a)x + (n - ab).

(i) The first integral, I1=(x4)14e4x1+x2(4x31)dxI_1 = \int \frac{(x - 4)^{14} e^{4x}}{\sqrt{1 + x^2}} (4x^3 - 1) dx, might reasonably be expected to be a very

straightforward application of the general result, and so it proves to be. With n=15n = 15, and taking a=b=4a = b = 4, so that q(x)=4x31q(x) = 4x^3 - 1 (which really should be checked explicitly), we find I1=(x4)15e4x1+x2(+C).I_1 = (x - 4)^{15} e^{4x} \sqrt{1 + x^2} (+ C).

(ii) This second integral, I2=(x1)21e12x1+x2(12x4x211)dxI_2 = \int \frac{(x - 1)^{21} e^{12x}}{\sqrt{1 + x^2}} (12x^4 - x^2 - 11) dx, is clearly not so straightforward,

since the bracketed term is now quartic. Of the many things one might try, however, surely the simplest is to try to factor out a linear term, the obvious candidate being (x1)(x - 1).

Finding that 12x4x211(x1)(12x3+12x2+11x+11)12x^4 - x^2 - 11 \equiv (x - 1)(12x^3 + 12x^2 + 11x + 11), we now try n=23,a=1,b=12n = 23, a = 1, b = 12 to obtain q(x)=12x3+12x2+11x+11q(x) = 12x^3 + 12x^2 + 11x + 11 and I2=(x1)23e12x1+x2(+C).I_2 = (x - 1)^{23} e^{12x} \sqrt{1 + x^2} (+ C).

(iii) The final integral, I3=(x2)6e4x1+x2(4x4+x32)dxI_3 = \int \frac{(x - 2)^6 e^{4x}}{\sqrt{1 + x^2}} (4x^4 + x^3 - 2) dx, is clearly intended to be even less simple

than its predecessor. However, you might now suspect that “the next case up” is in there somewhere. So, if you try n=8,a=2,b=4n = 8, a = 2, b = 4, which gives dy8dx=(x2)7e4x1+x2{4x3+x2+2x}=(x2)6e4x1+x2{4x47x34x},\frac{dy_8}{dx} = \frac{(x - 2)^7 e^{4x}}{\sqrt{1 + x^2}} \{4x^3 + x^2 + 2x\} = \frac{(x - 2)^6 e^{4x}}{\sqrt{1 + x^2}} \{4x^4 - 7x^3 - 4x\},

as well as the obvious target n=7,a=2,b=4n = 7, a = 2, b = 4, which yields dy7dx=(x2)6e4x1+x2{4x3+2x1},\frac{dy_7}{dx} = \frac{(x - 2)^6 e^{4x}}{\sqrt{1 + x^2}} \{4x^3 + 2x - 1\},

It may now be clear that both are involved. Indeed, I3=(dy8dx+2dy7dx)dx=y8+2y7=(x2)7e4x1+x2(+C).I_3 = \int \left( \frac{dy_8}{dx} + 2 \frac{dy_7}{dx} \right) dx = y_8 + 2 y_7 = (x - 2)^7 e^{4x} \sqrt{1 + x^2} (+ C).

Model Solution

We write y=(xa)nebx1+x2y = (x - a)^n e^{bx} \sqrt{1 + x^2} as a product of three functions:

y=pqrwhere p=(xa)n,q=ebx,r=1+x2.y = p \cdot q \cdot r \qquad \text{where } p = (x - a)^n, \quad q = e^{bx}, \quad r = \sqrt{1 + x^2}.

Using the product rule y=pqr+pqr+pqry' = p'qr + pq'r + pqr', we compute each derivative:

p=n(xa)n1,q=bebx,r=x1+x2.p' = n(x - a)^{n-1}, \qquad q' = be^{bx}, \qquad r' = \frac{x}{\sqrt{1 + x^2}}.

Substituting:

dydx=n(xa)n1ebx1+x2+(xa)nbebx1+x2+(xa)nebxx1+x2.\frac{\mathrm{d}y}{\mathrm{d}x} = n(x - a)^{n-1} e^{bx} \sqrt{1 + x^2} + (x - a)^n b e^{bx} \sqrt{1 + x^2} + (x - a)^n e^{bx} \frac{x}{\sqrt{1 + x^2}}.

Factor out (xa)n1ebx1+x2\dfrac{(x - a)^{n-1} e^{bx}}{\sqrt{1 + x^2}} from each term (multiplying the first two terms by 1+x21+x2\dfrac{\sqrt{1 + x^2}}{\sqrt{1 + x^2}}):

dydx=(xa)n1ebx1+x2[n(1+x2)+b(xa)(1+x2)+x(xa)].\frac{\mathrm{d}y}{\mathrm{d}x} = \frac{(x - a)^{n-1} e^{bx}}{\sqrt{1 + x^2}} \Big[ n(1 + x^2) + b(x - a)(1 + x^2) + x(x - a) \Big].

Expanding the bracket:

q(x)=n+nx2+b(xa)+bx2(xa)+x2axq(x) = n + nx^2 + b(x - a) + bx^2(x - a) + x^2 - ax

=bx3+(n+1ab)x2+(ba)x+(nab).= bx^3 + (n + 1 - ab)x^2 + (b - a)x + (n - ab).

Since b0b \neq 0, the leading term is bx3bx^3, so q(x)q(x) is a cubic polynomial. \quad \blacksquare

Part (i) We seek n,a,bn, a, b such that the integrand equals dydx\dfrac{\mathrm{d}y}{\mathrm{d}x} for y=(xa)nebx1+x2y = (x - a)^n e^{bx} \sqrt{1 + x^2}.

The integrand contains (x4)14(x - 4)^{14}, so n1=14n - 1 = 14, giving n=15n = 15. Also a=4a = 4 and b=4b = 4.

We verify the cubic:

q(x)=4x3+(15+116)x2+(44)x+(1516)=4x31.q(x) = 4x^3 + (15 + 1 - 16)x^2 + (4 - 4)x + (15 - 16) = 4x^3 - 1.

This matches the polynomial in the integrand, so:

(x4)14e4x(4x31)1+x2dx=(x4)15e4x1+x2+C.\int \frac{(x - 4)^{14} e^{4x} (4x^3 - 1)}{\sqrt{1 + x^2}} \, \mathrm{d}x = (x - 4)^{15} e^{4x} \sqrt{1 + x^2} + C.

Part (ii) The polynomial 12x4x21112x^4 - x^2 - 11 is quartic, not cubic. Testing x=1x = 1: 12111=012 - 1 - 11 = 0, so (x1)(x - 1) is a factor. Dividing:

12x4x211=(x1)(12x3+12x2+11x+11).12x^4 - x^2 - 11 = (x - 1)(12x^3 + 12x^2 + 11x + 11).

The integrand becomes (x1)22e12x1+x2(12x3+12x2+11x+11)\dfrac{(x - 1)^{22} e^{12x}}{\sqrt{1 + x^2}} (12x^3 + 12x^2 + 11x + 11), so n1=22n - 1 = 22, giving n=23n = 23, with a=1a = 1 and b=12b = 12.

Checking the cubic:

q(x)=12x3+(23+112)x2+(121)x+(2312)=12x3+12x2+11x+11.q(x) = 12x^3 + (23 + 1 - 12)x^2 + (12 - 1)x + (23 - 12) = 12x^3 + 12x^2 + 11x + 11. \quad \checkmark

Therefore:

(x1)21e12x(12x4x211)1+x2dx=(x1)23e12x1+x2+C.\int \frac{(x - 1)^{21} e^{12x} (12x^4 - x^2 - 11)}{\sqrt{1 + x^2}} \, \mathrm{d}x = (x - 1)^{23} e^{12x} \sqrt{1 + x^2} + C.

Part (iii) The polynomial 4x4+x324x^4 + x^3 - 2 is quartic. Factoring out (x2)(x - 2) does not work (substituting x=2x = 2 gives 64+82064 + 8 - 2 \neq 0). Instead, we seek a linear combination of derivatives.

With a=2a = 2 and b=4b = 4, we compute q(x)q(x) for two values of nn:

For n=7n = 7: q7(x)=4x3+(7+18)x2+(42)x+(78)=4x3+2x1\quad q_7(x) = 4x^3 + (7 + 1 - 8)x^2 + (4 - 2)x + (7 - 8) = 4x^3 + 2x - 1,

so dy7dx=(x2)6e4x1+x2(4x3+2x1)\dfrac{\mathrm{d}y_7}{\mathrm{d}x} = \dfrac{(x - 2)^6 e^{4x}}{\sqrt{1 + x^2}} (4x^3 + 2x - 1).

For n=8n = 8: q8(x)=4x3+(8+18)x2+(42)x+(88)=4x3+x2+2x\quad q_8(x) = 4x^3 + (8 + 1 - 8)x^2 + (4 - 2)x + (8 - 8) = 4x^3 + x^2 + 2x,

so dy8dx=(x2)7e4x1+x2(4x3+x2+2x)=(x2)6e4x1+x2(x2)(4x3+x2+2x)\dfrac{\mathrm{d}y_8}{\mathrm{d}x} = \dfrac{(x - 2)^7 e^{4x}}{\sqrt{1 + x^2}} (4x^3 + x^2 + 2x) = \dfrac{(x - 2)^6 e^{4x}}{\sqrt{1 + x^2}} (x - 2)(4x^3 + x^2 + 2x).

Expanding (x2)(4x3+x2+2x)(x - 2)(4x^3 + x^2 + 2x):

4x4+x3+2x28x32x24x=4x47x34x.4x^4 + x^3 + 2x^2 - 8x^3 - 2x^2 - 4x = 4x^4 - 7x^3 - 4x.

Now we find β\beta such that dy8dx+βdy7dx\dfrac{\mathrm{d}y_8}{\mathrm{d}x} + \beta \dfrac{\mathrm{d}y_7}{\mathrm{d}x} gives the integrand:

(4x47x34x)+β(4x3+2x1)=4x4+x32.(4x^4 - 7x^3 - 4x) + \beta(4x^3 + 2x - 1) = 4x^4 + x^3 - 2.

Comparing coefficients:

  • x3x^3: 7+4β=1    β=2-7 + 4\beta = 1 \implies \beta = 2.
  • xx: 4+2(2)=0-4 + 2(2) = 0. \checkmark (no xx term in the target)
  • constant: (2)=2-(2) = -2. \checkmark

So:

(x2)6e4x(4x4+x32)1+x2dx=y8+2y7+C\int \frac{(x - 2)^6 e^{4x} (4x^4 + x^3 - 2)}{\sqrt{1 + x^2}} \, \mathrm{d}x = y_8 + 2y_7 + C

=(x2)8e4x1+x2+2(x2)7e4x1+x2+C= (x - 2)^8 e^{4x} \sqrt{1 + x^2} + 2(x - 2)^7 e^{4x} \sqrt{1 + x^2} + C

=(x2)7e4x1+x2[(x2)+2]+C= (x - 2)^7 e^{4x} \sqrt{1 + x^2} \big[(x - 2) + 2\big] + C

=x(x2)7e4x1+x2+C.= x(x - 2)^7 e^{4x} \sqrt{1 + x^2} + C.

Examiner Notes

In many ways, this question is little more than an academic exercise, since I can see no way in which these integrals would actually arise in any practical situation. I apologise for this. However, it was a good test of candidates’ ability to stretch a general result in different directions, probing them for increasing amounts of insight and perseverance. For future STEP-takers, the opening result is a good one for which to find a generalisation, and it is a possibly fruitful avenue to explore the “product rule of differentiation” for three terms (etc.), say y=pqry = pqr in this case. Such an approach might have helped to prevent some of the ghastly mix-ups in writing all the terms out that were to be found in the scripts. It was disappointing to see that so few candidates seemed to think that they should tidy up the answer and demonstrate that the left over bits did indeed form a cubic polynomial, as required by the question. In the end, we gave anyone the mark who simply observed that what was left was a cubic (if indeed that was the case in their working). Thereafter, (i) is a straightforward application of the result, requiring candidates only to identify the values of nn, aa and bb. However, even here, it was rare to see folks justifying the form of the cubic, which might have acted as a check for errors. In (ii), the polynomial term is no longer cubic, so candidates were expected to try to see if an extra factor of (x1)(x - 1) could be taken out to go with the other twenty-one (x1)(x - 1)s, which indeed it could. Checking the cubic’s terms was rather more important here. The final integral, in (iii), was difficult, and this was where candidates were ‘found out’ on this question. The obvious thing is to try and extract some (x2)(x - 2) factor(s) from the quartic polynomial, but this doesn’t work. Candidates may reflect that they shouldn’t have found this too much of a surprise, as that would simply have been repeating the “trick” of (ii). Though only a small minority realised it, the next most obvious possibility to try, having already found in (ii) that ‘the next case up’ gives a quartic rather than a cubic polynomial, is to try some combination of the obvious answer and the next one up, and this turns out to be exactly what is required.


Topic: 向量 (Vectors)  |  Difficulty: Standard  |  Marks: 20

8 The non-collinear points A,BA, B and CC have position vectors a, b and c, respectively. The points PP and QQ have position vectors p and q, respectively, given by

p=λa+(1λ)bandq=μa+(1μ)c\mathbf{p} = \lambda \mathbf{a} + (1 - \lambda) \mathbf{b} \quad \text{and} \quad \mathbf{q} = \mu \mathbf{a} + (1 - \mu) \mathbf{c}

where 0<λ<10 < \lambda < 1 and μ>1\mu > 1. Draw a diagram showing A,B,C,PA, B, C, P and QQ.

Given that CQ×BP=AB×AC\vec{CQ} \times \vec{BP} = \vec{AB} \times \vec{AC}, find μ\mu in terms of λ\lambda, and show that, for all values of λ\lambda, the line PQPQ passes through the fixed point DD, with position vector d given by d=a+b+c\mathbf{d} = -\mathbf{a} + \mathbf{b} + \mathbf{c}. What can be said about the quadrilateral ABDCABDC?

Hint

8 For the diagram, you are simply required to show PP on ABAB, strictly between AA and BB; and QQ on ACAC on other side of AA to CC. The two given parameters indicate that CQ=μACCQ = \mu AC and BP=λABBP = \lambda AB. Substituting these into the given expression, CQ×BP=AB×ACμACλAB=ABACCQ \times BP = AB \times AC \Rightarrow \mu AC \cdot \lambda AB = AB \cdot AC

μ=1λ\Rightarrow \mu = \frac{1}{\lambda}. [Notice that CQCQ, BPBP, etc., are scalar quantities, and hence the "×\times" cannot be the vector product!]

Writing the equation of line PQPQ in the form r=tp+(1t)q\mathbf{r} = t \mathbf{p} + (1 - t) \mathbf{q} for some scalar parameter tt and substituting the given forms for p\mathbf{p} and q\mathbf{q} gives r=tλa+t(1λ)b+(1t)μa+(1t)(1μ)c\mathbf{r} = t \lambda \mathbf{a} + t(1 - \lambda)\mathbf{b} + (1 - t) \mu \mathbf{a} + (1 - t)(1 - \mu)\mathbf{c}.

Eliminating μ=1λr=(tλ+1λtλ)a+t(1λ)b+(1t)(λ1λ)c\mu = \frac{1}{\lambda} \Rightarrow \mathbf{r} = \left( t \lambda + \frac{1}{\lambda} - \frac{t}{\lambda} \right) \mathbf{a} + t(1 - \lambda)\mathbf{b} + (1 - t) \left( \frac{\lambda - 1}{\lambda} \right) \mathbf{c}. Comparing this to the

given answer, we note that when t=11λt = \frac{1}{1 - \lambda} from the b-component, 1t=λλ11 - t = \frac{\lambda}{\lambda - 1}, etc., so that we do indeed get r=a+b+c\mathbf{r} = -\mathbf{a} + \mathbf{b} + \mathbf{c}, as required.

Since dc=ba\mathbf{d} - \mathbf{c} = \mathbf{b} - \mathbf{a}, one pair of sides of opposite sides of ABDCABDC are equal and parallel, so we can conclude that ABDCABDC is a parallelogram

Model Solution

Diagram. The point PP lies on segment ABAB (since 0<λ<10 < \lambda < 1, it divides ABAB internally). The point QQ lies on line ACAC beyond AA from CC (since μ>1\mu > 1, we have CQ>CACQ > CA).

Finding μ\mu. We compute the relevant scalar lengths. Since

BP=pb=λa+(1λ)bb=λ(ab)=λAB,\vec{BP} = \mathbf{p} - \mathbf{b} = \lambda \mathbf{a} + (1 - \lambda)\mathbf{b} - \mathbf{b} = \lambda(\mathbf{a} - \mathbf{b}) = -\lambda \vec{AB},

we have BP=λABBP = \lambda \cdot AB. Similarly,

CQ=qc=μa+(1μ)cc=μ(ac)=μAC,\vec{CQ} = \mathbf{q} - \mathbf{c} = \mu \mathbf{a} + (1 - \mu)\mathbf{c} - \mathbf{c} = \mu(\mathbf{a} - \mathbf{c}) = -\mu \vec{AC},

so CQ=μACCQ = \mu \cdot AC.

The given condition CQ×BP=AB×AC\vec{CQ} \times \vec{BP} = \vec{AB} \times \vec{AC} uses ×\times to denote ordinary multiplication of scalar lengths (not the vector product). Substituting:

μACλAB=ABAC.\mu \cdot AC \cdot \lambda \cdot AB = AB \cdot AC.

Since A,B,CA, B, C are non-collinear, ABAB and ACAC are non-zero, so we can cancel to get:

λμ=1μ=1λ.\lambda \mu = 1 \qquad \Longrightarrow \qquad \mu = \frac{1}{\lambda}.

Since 0<λ<10 < \lambda < 1, this gives μ>1\mu > 1, consistent with the given constraint. \quad \blacksquare

Showing PQPQ passes through a fixed point. A general point on line PQPQ has position vector

r=tp+(1t)q\mathbf{r} = t\mathbf{p} + (1 - t)\mathbf{q}

for some scalar parameter tt. Substituting the expressions for p\mathbf{p} and q\mathbf{q}:

r=t[λa+(1λ)b]+(1t)[μa+(1μ)c]\mathbf{r} = t\big[\lambda \mathbf{a} + (1 - \lambda)\mathbf{b}\big] + (1 - t)\big[\mu \mathbf{a} + (1 - \mu)\mathbf{c}\big]

=[tλ+(1t)μ]a+t(1λ)b+(1t)(1μ)c.= \big[t\lambda + (1 - t)\mu\big]\mathbf{a} + t(1 - \lambda)\mathbf{b} + (1 - t)(1 - \mu)\mathbf{c}.

Substituting μ=1λ\mu = \dfrac{1}{\lambda}:

r=[tλ+1tλ]a+t(1λ)b+(1t)(11λ)c.\mathbf{r} = \left[t\lambda + \frac{1 - t}{\lambda}\right]\mathbf{a} + t(1 - \lambda)\mathbf{b} + (1 - t)\left(1 - \frac{1}{\lambda}\right)\mathbf{c}.

We want to find a value of tt (depending on λ\lambda) for which r\mathbf{r} is independent of λ\lambda. Setting the coefficient of b\mathbf{b} equal to 1:

t(1λ)=1t=11λ.t(1 - \lambda) = 1 \qquad \Longrightarrow \qquad t = \frac{1}{1 - \lambda}.

Then 1t=111λ=λ1λ1 - t = 1 - \dfrac{1}{1 - \lambda} = \dfrac{-\lambda}{1 - \lambda}.

Coefficient of c\mathbf{c}:

(1t)(11λ)=λ1λλ1λ=λ1λ(1λ)λ=1.(1 - t)\left(1 - \frac{1}{\lambda}\right) = \frac{-\lambda}{1 - \lambda} \cdot \frac{\lambda - 1}{\lambda} = \frac{-\lambda}{1 - \lambda} \cdot \frac{-(1 - \lambda)}{\lambda} = 1.

Coefficient of a\mathbf{a}:

tλ+(1t)1λ=λ1λ+λ1λ1λ=λ1λ11λ=λ11λ=1.t\lambda + (1 - t) \cdot \frac{1}{\lambda} = \frac{\lambda}{1 - \lambda} + \frac{-\lambda}{1 - \lambda} \cdot \frac{1}{\lambda} = \frac{\lambda}{1 - \lambda} - \frac{1}{1 - \lambda} = \frac{\lambda - 1}{1 - \lambda} = -1.

Therefore, for this value of tt (which depends on λ\lambda), we obtain

r=a+b+c=d,\mathbf{r} = -\mathbf{a} + \mathbf{b} + \mathbf{c} = \mathbf{d},

which is independent of λ\lambda. This shows that the line PQPQ passes through the fixed point DD with position vector d=a+b+c\mathbf{d} = -\mathbf{a} + \mathbf{b} + \mathbf{c} for all values of λ\lambda. \quad \blacksquare

The quadrilateral ABDCABDC. We compute:

AB=ba,CD=dc=(a+b+c)c=ba=AB.\vec{AB} = \mathbf{b} - \mathbf{a}, \qquad \vec{CD} = \mathbf{d} - \mathbf{c} = (-\mathbf{a} + \mathbf{b} + \mathbf{c}) - \mathbf{c} = \mathbf{b} - \mathbf{a} = \vec{AB}.

Since CD=AB\vec{CD} = \vec{AB}, the sides ABAB and CDCD are equal in length and parallel. Therefore ABDCABDC is a parallelogram.

Examiner Notes

The vectors question was the least popular pure maths question by a considerable way, and only marginally more popular than most of the applied questions. In general, attempts were short-lived and candidates usually gave up when the algebra got a bit “iffy”. Strangely, an awful lot of attempts began very poorly indeed; the ranges of values of λ\lambda and μ\mu had a geometric significance relating to where PP and QQ lay on the lines ABAB and ACAC, and these were not well grasped. Moreover, it was surprising to see diagrams in which the lines had not even been drawn, often leaving the marker to guess whether the points were supposed to be on them or not. Many responses to the next part were so bizarre that they were almost funny: a lot of candidates thought that CQCQ etc. were vectors rather than lengths, and the “×\times” was treated variously as a scalar multiplication, the scalar product and the vector product. Oddly enough, they could all lead to the required answer, λμ=1\lambda\mu = 1, even legitimately (with a bit of care) though we were harsh on statements that were actually nonsense. Very few made it to the later stages of the question.